CymitQuimica logo

CAS 939986-21-7

:

1,1-Dimethylethyl 3-[[(3-cyano-2-pyridinyl)amino]methyl]-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 3-[[(3-cyano-2-pyridinyl)amino]methyl]-1-piperidinecarboxylate, identified by its CAS number 939986-21-7, is a chemical compound that features a complex structure incorporating a piperidine ring, a cyano group, and a carboxylate functional group. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the pyridine moiety suggests possible interactions with biological targets, making it of interest in drug development. Additionally, the dimethyl group contributes to its steric properties, which can influence its reactivity and solubility. The compound is typically synthesized through multi-step organic reactions, and its stability and reactivity can be influenced by the surrounding functional groups. As with many organic compounds, proper handling and safety measures are essential due to potential toxicity or reactivity. Overall, this compound exemplifies the complexity and diversity of organic molecules used in pharmaceutical research.
Formula:C17H24N4O2
InChI:InChI=1S/C17H24N4O2/c1-17(2,3)23-16(22)21-9-5-6-13(12-21)11-20-15-14(10-18)7-4-8-19-15/h4,7-8,13H,5-6,9,11-12H2,1-3H3,(H,19,20)
InChI key:InChIKey=UXAHHDGGLPMNHU-UHFFFAOYSA-N
SMILES:N(CC1CN(C(OC(C)(C)C)=O)CCC1)C2=C(C#N)C=CC=N2
Synonyms:
  • 1-Piperidinecarboxylic acid, 3-[[(3-cyano-2-pyridinyl)amino]methyl]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 3-[[(3-cyano-2-pyridinyl)amino]methyl]-1-piperidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.