CAS 939986-30-8
:1,1-Dimethylethyl 4-[[(4-methyl-2-pyridinyl)amino]methyl]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 4-[[(4-methyl-2-pyridinyl)amino]methyl]-1-piperidinecarboxylate, identified by its CAS number 939986-30-8, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyridine moiety. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, potentially influencing its biological activity and solubility. The presence of the amino group linked to the pyridine suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The carboxylate functional group indicates that it may exhibit acidic properties, which can affect its reactivity and interactions in various environments. Overall, the compound's unique structural features may confer specific pharmacological properties, making it a candidate for further research in drug development or other applications in organic synthesis. However, detailed studies would be necessary to fully elucidate its properties, including its stability, solubility, and biological activity.
Formula:C17H27N3O2
InChI:InChI=1S/C17H27N3O2/c1-13-5-8-18-15(11-13)19-12-14-6-9-20(10-7-14)16(21)22-17(2,3)4/h5,8,11,14H,6-7,9-10,12H2,1-4H3,(H,18,19)
InChI key:InChIKey=FZOKXFGFBYXZRT-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC(CNC2=CC(C)=CC=N2)CC1
Synonyms:- 1-Piperidinecarboxylic acid, 4-[[(4-methyl-2-pyridinyl)amino]methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 4-[[(4-methyl-2-pyridinyl)amino]methyl]-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.