CAS 939986-39-7
:1,1-Dimethylethyl 3-[[(6-chloro-3-pyridinyl)methoxy]methyl]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 3-[[(6-chloro-3-pyridinyl)methoxy]methyl]-1-piperidinecarboxylate, with CAS number 939986-39-7, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a carboxylate group, and a pyridine moiety substituted with a chlorine atom. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents, depending on the specific functional groups present. The presence of the dimethyl group suggests potential steric hindrance, which could influence its reactivity and interaction with biological targets. Additionally, the chlorinated pyridine component may impart unique electronic properties, making it of interest in medicinal chemistry and drug development. The compound's synthesis and characterization would involve standard organic chemistry techniques, and its potential applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and efficacy. As with many such compounds, safety and handling precautions should be observed due to the presence of chlorine and other reactive functional groups.
Formula:C17H25ClN2O3
InChI:InChI=1S/C17H25ClN2O3/c1-17(2,3)23-16(21)20-8-4-5-14(10-20)12-22-11-13-6-7-15(18)19-9-13/h6-7,9,14H,4-5,8,10-12H2,1-3H3
InChI key:InChIKey=IRIFZBKETFWJPE-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(COCC=2C=CC(Cl)=NC2)CCC1
Synonyms:- 1-Piperidinecarboxylic acid, 3-[[(6-chloro-3-pyridinyl)methoxy]methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 3-[[(6-chloro-3-pyridinyl)methoxy]methyl]-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.