CymitQuimica logo

CAS 939986-50-2

:

1-[(2-Chloro-5-thiazolyl)methyl]-4-piperidinol

Description:
1-[(2-Chloro-5-thiazolyl)methyl]-4-piperidinol, with the CAS number 939986-50-2, is a chemical compound characterized by its unique structural features, which include a piperidine ring and a thiazole moiety. The presence of the chloro group on the thiazole ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic heterocyclic compound due to the incorporation of nitrogen and sulfur in its structure. It may exhibit properties such as solubility in polar solvents, and its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for its pharmacological properties in various biological assays. As with many compounds in this class, safety and handling precautions are essential due to the presence of halogenated and heterocyclic components, which can influence toxicity and environmental impact.
Formula:C9H13ClN2OS
InChI:InChI=1S/C9H13ClN2OS/c10-9-11-5-8(14-9)6-12-3-1-7(13)2-4-12/h5,7,13H,1-4,6H2
InChI key:InChIKey=KPRKORRAKBPQJI-UHFFFAOYSA-N
SMILES:C(C=1SC(Cl)=NC1)N2CCC(O)CC2
Synonyms:
  • 1-[(2-Chloro-5-thiazolyl)methyl]-4-piperidinol
  • 1-[(2-Chloro-1,3-thiazol-5-yl)methyl]piperidin-4-ol
  • 4-Piperidinol, 1-[(2-chloro-5-thiazolyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.