CymitQuimica logo

CAS 939986-60-4

:

1,1-Dimethylethyl 3-[(5-nitro-2-pyridinyl)oxy]-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 3-[(5-nitro-2-pyridinyl)oxy]-1-piperidinecarboxylate, with the CAS number 939986-60-4, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) and a nitro-substituted pyridine moiety, which contributes to its potential biological activity. The ester functional group in the structure indicates that it can undergo hydrolysis, making it relevant in various chemical reactions. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and interaction with biological targets. Additionally, the presence of the piperidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Overall, this compound's unique structural features may confer specific properties that are of interest in both synthetic and biological chemistry contexts.
Formula:C15H21N3O5
InChI:InChI=1S/C15H21N3O5/c1-15(2,3)23-14(19)17-8-4-5-12(10-17)22-13-7-6-11(9-16-13)18(20)21/h6-7,9,12H,4-5,8,10H2,1-3H3
InChI key:InChIKey=IJLKUIAADAPLFZ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(OC2=CC=C(N(=O)=O)C=N2)CCC1
Synonyms:
  • 1,1-Dimethylethyl 3-[(5-nitro-2-pyridinyl)oxy]-1-piperidinecarboxylate
  • 1-Piperidinecarboxylic acid, 3-[(5-nitro-2-pyridinyl)oxy]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.