CAS 939986-61-5

1,1-Dimethylethyl 3-[[(5-nitro-2-pyridinyl)oxy]methyl]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-[[(5-nitro-2-pyridinyl)oxy]methyl]-1-piperidinecarboxylate, identified by its CAS number 939986-61-5, is a chemical compound that features a complex structure incorporating a piperidine ring, a nitro-substituted pyridine moiety, and an ester functional group. This compound is characterized by its potential biological activity, often explored in pharmaceutical research for its efficacy in various therapeutic applications. The presence of the nitro group on the pyridine ring may contribute to its reactivity and interaction with biological targets. Additionally, the dimethyl substituents on the piperidine enhance its lipophilicity, potentially influencing its pharmacokinetic properties. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₆H₂₃N₃O₅

InChI: InChI=1S/C16H23N3O5/c1-16(2,3)24-15(20)18-8-4-5-12(10-18)11-23-14-7-6-13(9-17-14)19(21)22/h6-7,9,12H,4-5,8,10-11H2,1-3H3

InChI key: InChIKey=VDSNKAVVLFWMIZ-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(N(=O)=O)C=N1)C2CN(C(OC(C)(C)C)=O)CCC2

Synonyms:

• 1,1-Dimethylethyl 3-[[(5-nitro-2-pyridinyl)oxy]methyl]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-[[(5-nitro-2-pyridinyl)oxy]methyl]-, 1,1-dimethylethyl ester