CymitQuimica logo

CAS 939986-72-8

:

1-(5-Methyl-2-pyridinyl)-3-piperidinemethanol

Description:
1-(5-Methyl-2-pyridinyl)-3-piperidinemethanol, with the CAS number 939986-72-8, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a pyridine ring, which is a five-membered aromatic ring with one nitrogen atom. The presence of the methyl group on the pyridine ring contributes to its lipophilicity, potentially influencing its biological activity and solubility. The hydroxymethyl group attached to the piperidine ring suggests that the compound may exhibit properties typical of alcohols, such as hydrogen bonding capabilities. This compound may be of interest in medicinal chemistry due to its potential interactions with biological targets, possibly serving as a lead compound for drug development. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods or detailed literature review, as they are crucial for understanding its behavior in various applications.
Formula:C12H18N2O
InChI:InChI=1S/C12H18N2O/c1-10-4-5-12(13-7-10)14-6-2-3-11(8-14)9-15/h4-5,7,11,15H,2-3,6,8-9H2,1H3
InChI key:InChIKey=JLZKQAIEDWQNSC-UHFFFAOYSA-N
SMILES:C(O)C1CN(CCC1)C2=CC=C(C)C=N2
Synonyms:
  • 3-Piperidinemethanol, 1-(5-methyl-2-pyridinyl)-
  • 1-(5-Methyl-2-pyridinyl)-3-piperidinemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.