CAS 939986-81-9
:1-(4-Methyl-2-pyridinyl)-3-piperidinol
Description:
1-(4-Methyl-2-pyridinyl)-3-piperidinol, identified by its CAS number 939986-81-9, is a chemical compound characterized by its unique structure that includes a pyridine ring and a piperidine moiety. This compound typically exhibits properties associated with both heterocyclic amines and alcohols, which can influence its solubility and reactivity. It is likely to be a solid at room temperature, with moderate polarity due to the presence of the hydroxyl group. The methyl group on the pyridine ring can affect its electronic properties, potentially enhancing its lipophilicity and biological activity. Such compounds are often studied for their pharmacological potential, particularly in the context of neuroactive agents or as intermediates in organic synthesis. Additionally, the presence of both nitrogen-containing rings may contribute to its ability to interact with biological targets, making it of interest in medicinal chemistry. As with any chemical substance, safety data and handling precautions should be consulted before use.
Formula:C11H16N2O
InChI:InChI=1S/C11H16N2O/c1-9-4-5-12-11(7-9)13-6-2-3-10(14)8-13/h4-5,7,10,14H,2-3,6,8H2,1H3
InChI key:InChIKey=SCTIQWGQWHMGBR-UHFFFAOYSA-N
SMILES:CC=1C=C(N=CC1)N2CC(O)CCC2
Synonyms:- 3-Piperidinol, 1-(4-methyl-2-pyridinyl)-
- 1-(4-Methyl-2-pyridinyl)-3-piperidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
