CymitQuimica logo

CAS 939986-82-0

:

1-(4-Methyl-2-pyridinyl)-3-piperidinemethanol

Description:
1-(4-Methyl-2-pyridinyl)-3-piperidinemethanol, identified by its CAS number 939986-82-0, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a piperidine moiety. This compound typically exhibits properties associated with both heterocyclic and aliphatic amines, such as potential basicity due to the presence of nitrogen atoms in its rings. It is likely to be a solid at room temperature, with solubility in polar solvents due to the hydroxyl group present in its structure. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular interactions could involve hydrogen bonding and other non-covalent interactions, influencing its reactivity and potential applications. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles. Overall, 1-(4-Methyl-2-pyridinyl)-3-piperidinemethanol represents a unique structure that may have significant implications in various chemical and biological contexts.
Formula:C12H18N2O
InChI:InChI=1S/C12H18N2O/c1-10-4-5-13-12(7-10)14-6-2-3-11(8-14)9-15/h4-5,7,11,15H,2-3,6,8-9H2,1H3
InChI key:InChIKey=NFEBSMSULMRMFL-UHFFFAOYSA-N
SMILES:C(O)C1CN(CCC1)C2=CC(C)=CC=N2
Synonyms:
  • 1-(4-Methyl-2-pyridinyl)-3-piperidinemethanol
  • 3-Piperidinemethanol, 1-(4-methyl-2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.