CymitQuimica logo

CAS 939986-86-4

:

4-Pyridinecarbonitrile, 2-[3-(hydroxymethyl)-1-piperidinyl]-

Description:
4-Pyridinecarbonitrile, 2-[3-(hydroxymethyl)-1-piperidinyl]- is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its unique properties. The presence of a nitrile group (–C≡N) indicates potential reactivity and polarity, while the hydroxymethyl group (–CH2OH) enhances its solubility in polar solvents and may participate in hydrogen bonding. This compound is likely to exhibit basic properties due to the nitrogen atoms in the piperidine and pyridine rings, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit biological activity. Additionally, the presence of multiple functional groups may allow for further derivatization, expanding its utility in synthetic chemistry. Overall, 4-Pyridinecarbonitrile, 2-[3-(hydroxymethyl)-1-piperidinyl]- is a versatile compound with interesting chemical behavior and potential applications in various fields.
Formula:C12H15N3O
InChI:InChI=1S/C12H15N3O/c13-7-10-3-4-14-12(6-10)15-5-1-2-11(8-15)9-16/h3-4,6,11,16H,1-2,5,8-9H2
InChI key:InChIKey=IZOXSCIVMIMDSG-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(N=CC1)N2CC(CO)CCC2
Synonyms:
  • 2-[3-(Hydroxymethyl)-1-piperidinyl]-4-pyridinecarbonitrile
  • 4-Pyridinecarbonitrile, 2-[3-(hydroxymethyl)-1-piperidinyl]-
  • 2-[3-(Hydroxymethyl)piperidin-1-yl]pyridine-4-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.