CymitQuimica logo

CAS 939986-87-5

:

1-(2-Pyrazinyl)-3-piperidinol

Description:
1-(2-Pyrazinyl)-3-piperidinol is a chemical compound characterized by its unique structure, which includes a pyrazine ring and a piperidine moiety. The presence of the pyrazine ring contributes to its aromatic properties and potential biological activity, while the piperidinol part introduces a hydroxyl group, which can participate in hydrogen bonding and influence the compound's solubility and reactivity. This compound is typically classified as an organic heterocyclic compound due to the presence of nitrogen atoms in both the pyrazine and piperidine rings. It may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. The molecular structure allows for potential interactions with biological targets, which could lead to therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1-(2-Pyrazinyl)-3-piperidinol represents a class of compounds that may have significant implications in pharmaceutical research.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c13-8-2-1-5-12(7-8)9-6-10-3-4-11-9/h3-4,6,8,13H,1-2,5,7H2
InChI key:InChIKey=UIZANPSGIGOEEI-UHFFFAOYSA-N
SMILES:OC1CN(CCC1)C=2C=NC=CN2
Synonyms:
  • 3-Piperidinol, 1-(2-pyrazinyl)-
  • 1-(2-Pyrazinyl)-3-piperidinol
  • 1-(Pyrazin-2-yl)piperidin-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.