CymitQuimica logo

CAS 939986-88-6

:

1-(3-Chloro-2-quinoxalinyl)-4-piperidinecarboxylic acid

Description:
1-(3-Chloro-2-quinoxalinyl)-4-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a quinoxaline moiety and a piperidine ring. The presence of the chloro group at the 3-position of the quinoxaline contributes to its reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in polar solvents, which can be attributed to the carboxylic acid functional group. The piperidine ring enhances its pharmacological profile, potentially influencing its interaction with biological targets. As a result, compounds of this nature are often investigated for their medicinal properties, including potential applications in neuropharmacology or as therapeutic agents. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the compound's purity and the conditions under which it is analyzed. Overall, 1-(3-Chloro-2-quinoxalinyl)-4-piperidinecarboxylic acid represents a class of compounds that may hold significance in drug discovery and development.
Formula:C14H14ClN3O2
InChI:InChI=1S/C14H14ClN3O2/c15-12-13(17-11-4-2-1-3-10(11)16-12)18-7-5-9(6-8-18)14(19)20/h1-4,9H,5-8H2,(H,19,20)
InChI key:InChIKey=KQYNFVSYNSPJEG-UHFFFAOYSA-N
SMILES:ClC=1C(=NC2=C(N1)C=CC=C2)N3CCC(C(O)=O)CC3
Synonyms:
  • 1-(3-Chloro-2-quinoxalinyl)-4-piperidinecarboxylic acid
  • 4-Piperidinecarboxylic acid, 1-(3-chloro-2-quinoxalinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.