CAS 939986-89-7
:1,1-Dimethylethyl 4-[(3-chloro-2-quinoxalinyl)amino]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 4-[(3-chloro-2-quinoxalinyl)amino]-1-piperidinecarboxylate, with the CAS number 939986-89-7, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a quinoxaline moiety. This compound typically exhibits properties associated with both amines and esters, given its functional groups. It is likely to be a solid at room temperature and may have moderate solubility in organic solvents, depending on the specific substituents and their interactions. The presence of the chloro group suggests potential reactivity, which could be exploited in various chemical reactions or biological applications. Additionally, the dimethyl group contributes to steric hindrance, potentially influencing the compound's biological activity and interaction with target sites. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C18H23ClN4O2
InChI:InChI=1S/C18H23ClN4O2/c1-18(2,3)25-17(24)23-10-8-12(9-11-23)20-16-15(19)21-13-6-4-5-7-14(13)22-16/h4-7,12H,8-11H2,1-3H3,(H,20,22)
InChI key:InChIKey=RKSROIYKSSMFBZ-UHFFFAOYSA-N
SMILES:N(C1=NC2=C(N=C1Cl)C=CC=C2)C3CCN(C(OC(C)(C)C)=O)CC3
Synonyms:- 1,1-Dimethylethyl 4-[(3-chloro-2-quinoxalinyl)amino]-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 4-[(3-chloro-2-quinoxalinyl)amino]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.