CAS 939986-92-2
:1-(6-Chloro-3-pyridazinyl)-3-piperidinol
Description:
1-(6-Chloro-3-pyridazinyl)-3-piperidinol is a chemical compound characterized by its unique structural features, which include a pyridazine ring and a piperidinol moiety. The presence of the chloro substituent on the pyridazine ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic heterocyclic compound due to the incorporation of nitrogen atoms in its ring structures. It may exhibit properties such as solubility in polar solvents, depending on the specific functional groups and their arrangement. The piperidinol portion suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with various biological activities. Additionally, the compound's molecular weight, melting point, and other physical properties would be influenced by its specific structure and substituents. Overall, 1-(6-Chloro-3-pyridazinyl)-3-piperidinol represents a class of compounds that may be of interest in research and development within the fields of organic chemistry and drug discovery.
Formula:C9H12ClN3O
InChI:InChI=1S/C9H12ClN3O/c10-8-3-4-9(12-11-8)13-5-1-2-7(14)6-13/h3-4,7,14H,1-2,5-6H2
InChI key:InChIKey=KPHWCJVBMSJJCJ-UHFFFAOYSA-N
SMILES:OC1CN(CCC1)C2=CC=C(Cl)N=N2
Synonyms:- 3-Piperidinol, 1-(6-chloro-3-pyridazinyl)-
- 1-(6-Chloro-3-pyridazinyl)-3-piperidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
