CymitQuimica logo

CAS 939989-87-4

:

Benzenesulfonamide, 4-bromo-N,N-dimethyl-3-(trifluoromethyl)-

Description:
Benzenesulfonamide, 4-bromo-N,N-dimethyl-3-(trifluoromethyl)-, is an organic compound characterized by its sulfonamide functional group, which is attached to a benzene ring that features a bromine atom and a trifluoromethyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The dimethyl substitution on the nitrogen atom of the sulfonamide group contributes to its chemical stability and potential reactivity. As a sulfonamide, it may exhibit antibacterial properties, although specific biological activities would depend on the overall molecular structure and substituents. The compound's CAS number, 939989-87-4, allows for precise identification in chemical databases, facilitating research and application in various fields, including medicinal chemistry and agrochemicals. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C9H9BrF3NO2S
InChI:InChI=1S/C9H9BrF3NO2S/c1-14(2)17(15,16)6-3-4-8(10)7(5-6)9(11,12)13/h3-5H,1-2H3
InChI key:InChIKey=YHBPKKHFQCUHQC-UHFFFAOYSA-N
SMILES:S(N(C)C)(=O)(=O)C1=CC(C(F)(F)F)=C(Br)C=C1
Synonyms:
  • Benzenesulfonamide, 4-bromo-N,N-dimethyl-3-(trifluoromethyl)-
  • 4-Bromo-N,N-dimethyl-3-(trifluoromethyl)benzenesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.