CymitQuimica logo

CAS 939990-13-3

:

5-Chloro-1-fluoro-2-iodo-3-methylbenzene

Description:
5-Chloro-1-fluoro-2-iodo-3-methylbenzene, with the CAS number 939990-13-3, is an aromatic halogenated compound characterized by the presence of multiple halogen substituents and a methyl group on a benzene ring. The structure features a chlorine atom at the 5-position, a fluorine atom at the 1-position, and an iodine atom at the 2-position, along with a methyl group at the 3-position of the benzene ring. This compound is likely to exhibit unique chemical reactivity due to the presence of these electronegative halogens, which can influence its electrophilic substitution reactions and overall stability. The presence of multiple halogens can also affect its physical properties, such as solubility and boiling point, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound's halogenated nature may impart specific biological activities, warranting further investigation into its potential uses in medicinal chemistry. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C7H5ClFI
InChI:InChI=1S/C7H5ClFI/c1-4-2-5(8)3-6(9)7(4)10/h2-3H,1H3
InChI key:InChIKey=QZCKTTLCZDIDOP-UHFFFAOYSA-N
SMILES:IC1=C(C)C=C(Cl)C=C1F
Synonyms:
  • 5-Chloro-1-fluoro-2-iodo-3-methylbenzene
  • Benzene, 5-chloro-1-fluoro-2-iodo-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.