CymitQuimica logo

CAS 939999-69-6

:

3,4-dimethoxybenzenecarboximidohydrazide

Description:
3,4-Dimethoxybenzenecarboximidohydrazide is an organic compound characterized by the presence of a hydrazide functional group attached to a substituted aromatic ring. The compound features two methoxy groups (-OCH3) located at the 3 and 4 positions of the benzene ring, which influence its chemical reactivity and solubility. The carboximidohydrazide moiety contributes to its potential as a bioactive molecule, possibly exhibiting various pharmacological properties. The presence of the methoxy groups can enhance lipophilicity, potentially affecting its interaction with biological membranes. This compound may be synthesized through the reaction of appropriate hydrazine derivatives with carboxylic acids or their derivatives. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific data regarding its physical properties, such as melting point, solubility, and spectral characteristics, would require further investigation or experimental determination. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C9H13N3O2
InChI:InChI=1/C9H13N3O2/c1-13-7-4-3-6(9(10)12-11)5-8(7)14-2/h3-5H,11H2,1-2H3,(H2,10,12)
Synonyms:
  • 3,4-Dimethoxybenzolcarboximidohydrazid
  • benzenecarboximidic acid, 3,4-dimethoxy-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.