CAS 94-00-8

Isonicotinicacidphenylester; 99%

Description:

Isonicotinic acid phenyl ester, with the CAS number 94-00-8, is an organic compound derived from isonicotinic acid and phenol. It typically appears as a white to off-white crystalline solid. This compound is characterized by its aromatic structure, which contributes to its stability and potential reactivity. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. Isonicotinic acid phenyl ester is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals and agrochemicals. Its properties include a moderate melting point and a specific boiling point, which are indicative of its molecular structure. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and environmental impact. Overall, isonicotinic acid phenyl ester is a versatile compound with applications in various chemical research and industrial processes.

Formula: C₁₂H₉NO₂

InChI: InChI=1/C12H9NO2/c14-12(10-6-8-13-9-7-10)15-11-4-2-1-3-5-11/h1-9H

SMILES: c1ccc(cc1)OC(=O)c1ccncc1

Synonyms:

• Isonicotinic acid phenyl ester
• Phenyl Pyridine-4-Carboxylate

Phenyl Isonicotinate

CAS: 94-00-8

Formula: C₁₂H₉NO₂

Purity: >98.0%(GC)(T)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 199.21

Ref: 3B-I0142

Isonicotinic acid phenyl ester

CAS: 94-00-8

Formula: C₁₂H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 199.2054

Ref: IN-DA00GVSU

Phenyl Isonicotinate

CAS: 94-00-8

Phenyl Isonicotinate

Purity: 98%

Molecular weight: 199.21g/mol

Ref: 54-OR1014639

Phenyl isonicotinate

CAS: 94-00-8

Purity: 97%

Molecular weight: 199.2089996

Ref: 10-F725916