CAS 94-06-4
:4-(1-Methylbutyl)phenol
Description:
4-(1-Methylbutyl)phenol, also known by its CAS number 94-06-4, is an organic compound characterized by a phenolic structure with a branched alkyl substituent. This compound features a phenol group, which consists of a hydroxyl (-OH) group attached to a benzene ring, and a 1-methylbutyl group, which contributes to its hydrophobic properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the bulky alkyl group influences its physical properties, such as boiling point and solubility, making it less soluble in water but more soluble in organic solvents. 4-(1-Methylbutyl)phenol is primarily used as an intermediate in the synthesis of various chemical products, including antioxidants and surfactants. Additionally, it exhibits antimicrobial properties, which can be beneficial in certain applications. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled, and appropriate precautions should be taken during its use in industrial or laboratory settings.
Formula:C11H16O
InChI:InChI=1S/C11H16O/c1-3-4-9(2)10-5-7-11(12)8-6-10/h5-9,12H,3-4H2,1-2H3
InChI key:InChIKey=JTHGIRIGZAGNOX-UHFFFAOYSA-N
SMILES:C(CCC)(C)C1=CC=C(O)C=C1
Synonyms:- 2-(4-Hydroxyphenyl)pentane
- 4-(Pentan-2-Yl)Phenol
- NSC 7947
- Phenol, 4-(1-methylbutyl)-
- Phenol, p-(1-methylbutyl)-
- p-(1-Methylbutyl)phenol
- 4-(1-Methylbutyl)phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(1-Methylbutyl)phenol
CAS:Controlled ProductFormula:C11H16OColor and Shape:NeatMolecular weight:164.244
