
CAS 94-38-2
:3-(Diethylamino)-1-phenyl-1-propanone
Description:
3-(Diethylamino)-1-phenyl-1-propanone, commonly known as DEAP, is an organic compound characterized by its ketone functional group and a diethylamino substituent. It typically appears as a colorless to pale yellow liquid with a distinctive odor. The compound is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. DEAP is primarily used in organic synthesis and as a reagent in various chemical reactions, particularly in the production of pharmaceuticals and agrochemicals. Its structure includes a phenyl group attached to a propanone backbone, which contributes to its reactivity and potential applications in the synthesis of other compounds. Safety precautions are necessary when handling DEAP, as it may pose health risks if inhaled or absorbed through the skin. Proper storage in a cool, dry place away from incompatible substances is essential to maintain its stability and prevent degradation.
Formula:C13H19NO
InChI:InChI=1S/C13H19NO/c1-3-14(4-2)11-10-13(15)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3
InChI key:InChIKey=YZTCGYARZGKANI-UHFFFAOYSA-N
SMILES:C(CCN(CC)CC)(=O)C1=CC=CC=C1
Synonyms:- 3-(Diethylamino)propiophenone
- Propiophenone, 3-(diethylamino)-
- 3-(Diethylamino)-1-phenyl-1-propanone
- 1-Propanone, 3-(diethylamino)-1-phenyl-
- β-(N,N′-Diethylamino)propiophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.