CAS 940-05-6

2-bromo-1-(bromomethyl)-4-nitrobenzene

Description:

2-Bromo-1-(bromomethyl)-4-nitrobenzene, with the CAS number 940-05-6, is an organic compound characterized by the presence of both bromine and nitro functional groups attached to a benzene ring. This compound features a bromomethyl group (-CH2Br) and a nitro group (-NO2) at specific positions on the aromatic ring, which influences its reactivity and properties. It is typically a solid at room temperature and may exhibit a yellow to brown coloration. The presence of bromine atoms contributes to its potential as a halogenated compound, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The nitro group is known for its electron-withdrawing properties, which can affect the compound's electrophilicity and overall reactivity. Additionally, 2-bromo-1-(bromomethyl)-4-nitrobenzene may have applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health and environmental risks.

Formula: C₇H₅Br₂NO₂

InChI: InChI=1/C7H5Br2NO2/c8-4-5-1-2-6(10(11)12)3-7(5)9/h1-3H,4H2

SMILES: c1cc(cc(c1CBr)Br)N(=O)=O

Synonyms:

• Benzene, 2-Bromo-1-(Bromomethyl)-4-Nitro-
• 2-Bromo-1-(bromomethyl)-4-nitrobenzene

2-Bromo-1-(bromomethyl)-4-nitrobenzene

CAS: 940-05-6

Formula: C₇H₅Br₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 294.9281

Ref: IN-DA006T9Z

2-Bromo-4-nitrobenzyl bromide

CAS: 940-05-6

2-Bromo-4-nitrobenzyl bromide

Purity: 98%

Molecular weight: 294.93g/mol

Ref: 54-OR400065

2-Bromo-1-(bromomethyl)-4-nitrobenzene

CAS: 940-05-6

Formula: C₇H₅Br₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 294.93

Ref: 10-F213016

2-Bromo-1-(bromomethyl)-4-nitrobenzene

CAS: 940-05-6

Versatile small molecule scaffold

Formula: C₇H₅Br₂NO₂

Purity: Min. 95%

Molecular weight: 294.93 g/mol

Ref: 3D-AAA94005