CymitQuimica logo

CAS 940-36-3

:

methyl (4-chlorophenyl)carbamate

Description:
Methyl (4-chlorophenyl)carbamate, with the CAS number 940-36-3, is an organic compound that belongs to the class of carbamates. It is characterized by the presence of a carbamate functional group (-OC(=O)N-) attached to a methyl group and a 4-chlorophenyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its moderate solubility in organic solvents and limited solubility in water. Methyl (4-chlorophenyl)carbamate exhibits biological activity, often studied for its potential use in agricultural applications as a pesticide or herbicide. Its chemical structure allows it to interact with biological systems, which can lead to various toxicological effects. As with many carbamates, it may inhibit acetylcholinesterase, an important enzyme in the nervous system. Proper handling and safety precautions are essential due to its potential toxicity and environmental impact.
Formula:C8H8ClNO2
InChI:InChI=1/C8H8ClNO2/c1-12-8(11)10-7-4-2-6(9)3-5-7/h2-5H,1H3,(H,10,11)
InChI key:CRGWHGISCDFEJY-UHFFFAOYSA-N
SMILES:COC(=O)NC1=CC=C(C=C1)Cl
Synonyms:
  • Carbamic acid, (4-chlorophenyl)-, methyl ester
  • carbamic acid, N-(4-chlorophenyl)-, methyl ester
Found 6 products.