CAS 94001-67-9
:2-Hydroxy-3-(1-phenylethyl)benzenemethanol
Description:
2-Hydroxy-3-(1-phenylethyl)benzenemethanol, also known by its CAS number 94001-67-9, is an organic compound characterized by its phenolic structure. This substance features a hydroxyl group (-OH) attached to a benzene ring, which is further substituted with a phenylethyl group and a methanol moiety. The presence of the hydroxyl group contributes to its potential as a weak acid and influences its solubility in polar solvents. The compound exhibits properties typical of phenolic compounds, such as antioxidant activity, which can be attributed to the electron-donating nature of the hydroxyl group. Additionally, the bulky phenylethyl substituent may affect its steric hindrance and reactivity, making it of interest in various chemical reactions and applications, including pharmaceuticals and materials science. Its molecular structure suggests potential interactions with biological systems, which could be explored for therapeutic uses. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C15H16O2
InChI:InChI=1S/C15H16O2/c1-11(12-6-3-2-4-7-12)14-9-5-8-13(10-16)15(14)17/h2-9,11,16-17H,10H2,1H3
InChI key:InChIKey=BMLHCADWCYMYDL-UHFFFAOYSA-N
SMILES:C(C)(C1=C(O)C(CO)=CC=C1)C2=CC=CC=C2
Synonyms:- Benzenemethanol, 2-hydroxy-3-(1-phenylethyl)-
- Benzyl alcohol, 2-hydroxy-3-(α-methylbenzyl)-
- 2-Hydroxy-3-(1-phenylethyl)benzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(α-Methylbenzyl) Saligenin
CAS:Controlled ProductFormula:C15H16O2Color and Shape:NeatMolecular weight:228.29
