CAS 94006-32-3

Boric acid (H3BO3), compd. with 1,1′,1′′-nitrilotris[2-propanol]

Description:

Boric acid (H3BO3) is a weak acid that is often used as an antiseptic, insecticide, and in various industrial applications. When it forms a compound with 1,1′,1′′-nitrilotris[2-propanol], it exhibits unique characteristics due to the presence of the nitrilotrispropanol moiety, which can enhance solubility and stability in aqueous solutions. This compound typically features a complex structure that allows for multiple hydrogen bonding interactions, which can influence its reactivity and biological activity. The presence of hydroxyl groups from the nitrilotrispropanol contributes to its potential as a chelating agent, enabling it to interact with metal ions. Additionally, the compound may exhibit low toxicity, making it suitable for various applications in pharmaceuticals and agriculture. Its properties, such as pH stability and compatibility with other substances, can vary based on concentration and environmental conditions. Overall, this compound combines the characteristics of boric acid with the functional benefits of nitrilotrispropanol, leading to diverse applications in both industrial and research settings.

Formula: C₉H₂₁NO₃·xBH₃O₃

InChI: InChI=1S/C9H21NO3.BH3O3/c1-7(11)4-10(5-8(2)12)6-9(3)13;2-1(3)4/h7-9,11-13H,4-6H2,1-3H3;2-4H

InChI key: InChIKey=CPWQCOUYAHEWNK-UHFFFAOYSA-N

SMILES: B(O)(O)O.N(CC(C)O)(CC(C)O)CC(C)O

Synonyms:

• 2-Propanol, 1,1′,1′′-nitrilotris-, compd. with boric acid (H3BO3)
• Boric acid (H3BO3), compd. with 1,1′,1′′-nitrilotris[2-propanol]

Boric acid (H3BO3), compd. with 1,1′,1′′-nitrilotris[2-propanol]

CAS: 94006-32-3

Formula: C₉H₂₄BNO₆

Molecular weight: 253.1010

Ref: IN-DA01OHVK