CymitQuimica logo

CAS 940062-20-4

:

N-[2-(1-Piperazinyl)ethyl]methanesulfonamide

Description:
N-[2-(1-Piperazinyl)ethyl]methanesulfonamide is a chemical compound characterized by its piperazine moiety, which contributes to its potential biological activity. This substance features a methanesulfonamide functional group, indicating it has sulfonamide characteristics that may influence its solubility and reactivity. The presence of the piperazine ring suggests that it may interact with biological targets, potentially serving as a pharmacophore in medicinal chemistry. Typically, compounds like this can exhibit properties such as moderate to high solubility in polar solvents, and they may possess basic characteristics due to the piperazine nitrogen atoms. The compound's structure allows for various interactions, including hydrogen bonding and electrostatic interactions, which are crucial for its biological activity. Additionally, the methanesulfonamide group may enhance its stability and bioavailability. Overall, N-[2-(1-Piperazinyl)ethyl]methanesulfonamide is of interest in pharmaceutical research, particularly in the development of therapeutic agents targeting various conditions.
Formula:C7H17N3O2S
InChI:InChI=1S/C7H17N3O2S/c1-13(11,12)9-4-7-10-5-2-8-3-6-10/h8-9H,2-7H2,1H3
InChI key:InChIKey=VEVPKZFGXDGXNV-UHFFFAOYSA-N
SMILES:C(CNS(C)(=O)=O)N1CCNCC1
Synonyms:
  • Methanesulfonamide, N-[2-(1-piperazinyl)ethyl]-
  • N-[2-(1-Piperazinyl)ethyl]methanesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.