
CAS 94008-47-6
:3,4-Dihydro-7,8-dihydroxy-2-methyl-2H-1-benzopyran-6-carboxaldehyde
Description:
3,4-Dihydro-7,8-dihydroxy-2-methyl-2H-1-benzopyran-6-carboxaldehyde, with the CAS number 94008-47-6, is a chemical compound that belongs to the class of flavonoids, specifically a type of benzopyran. This compound features a benzopyran core structure, which is characterized by a fused benzene and pyran ring. The presence of hydroxyl groups at the 7 and 8 positions contributes to its potential antioxidant properties, while the aldehyde functional group at the 6 position may influence its reactivity and biological activity. The methyl group at the 2 position can affect the compound's solubility and stability. This substance is of interest in various fields, including medicinal chemistry and natural product research, due to its potential therapeutic applications. Its structural characteristics suggest that it may exhibit various biological activities, including anti-inflammatory and antioxidant effects, although specific studies would be necessary to confirm these properties and elucidate its mechanisms of action.
Formula:C11H12O4
InChI:InChI=1S/C11H12O4/c1-6-2-3-7-4-8(5-12)9(13)10(14)11(7)15-6/h4-6,13-14H,2-3H2,1H3
InChI key:InChIKey=SFYLLLGAVDGGFQ-UHFFFAOYSA-N
SMILES:OC1=C2C(=CC(C=O)=C1O)CCC(C)O2
Synonyms:- 2H-1-Benzopyran-6-carboxaldehyde, 3,4-dihydro-7,8-dihydroxy-2-methyl-
- 3,4-Dihydro-7,8-dihydroxy-2-methyl-2H-1-benzopyran-6-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.