
CAS 94015-06-2
:Ethyl 3-(chloromethyl)-2-pyridinecarboxylate
Description:
Ethyl 3-(chloromethyl)-2-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a carboxylate ester functional group, contributing to its reactivity and solubility properties. The presence of a chloromethyl group enhances its electrophilic character, making it a potential intermediate in various organic synthesis reactions. Ethyl 3-(chloromethyl)-2-pyridinecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic ethyl group. The compound is of interest in medicinal chemistry and agrochemical applications, where it may serve as a building block for more complex molecules. As with many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this substance in a laboratory setting.
Formula:C9H10ClNO2
InChI:InChI=1S/C9H10ClNO2/c1-2-13-9(12)8-7(6-10)4-3-5-11-8/h3-5H,2,6H2,1H3
InChI key:InChIKey=NMKVGHRJQNAOBS-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(CCl)C=CC=N1
Synonyms:- Ethyl 3-(chloromethyl)-2-pyridinecarboxylate
- 2-Pyridinecarboxylic acid, 3-(chloromethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.