CAS 94022-98-7
:1-(2-Iodoethyl)-2-(trifluoromethyl)benzene
Description:
1-(2-Iodoethyl)-2-(trifluoromethyl)benzene, with the CAS number 94022-98-7, is an organic compound characterized by the presence of both an iodoethyl group and a trifluoromethyl group attached to a benzene ring. This compound features a benzene ring substituted at the second position with a trifluoromethyl group, which is known for its electron-withdrawing properties, enhancing the compound's reactivity in various chemical reactions. The iodoethyl group, located at the first position, introduces a halogen that can participate in nucleophilic substitution reactions, making the compound useful in synthetic organic chemistry. The presence of the trifluoromethyl group also contributes to the compound's lipophilicity and potential applications in pharmaceuticals and agrochemicals. Additionally, the compound's molecular structure suggests it may exhibit unique physical properties, such as a specific boiling point and solubility characteristics, influenced by the halogen and trifluoromethyl substituents. Overall, this compound is of interest for its potential applications in various fields, including medicinal chemistry and materials science.
Formula:C9H8F3I
InChI:InChI=1/C9H8F3I/c10-9(11,12)8-4-2-1-3-7(8)5-6-13/h1-4H,5-6H2
InChI key:InChIKey=HIPIOCUVIHLDIP-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(CCI)C=CC=C1
Synonyms:- 1-(2-Iodoethyl)-2-(Trifluoromethyl)Benzene
- 1-Iodo-2-(2-trifluoromethylphenyl)ethane
- Benzene, 1-(2-iodoethyl)-2-(trifluoromethyl)-
- alpha,alpha,alpha-Trifluoro-2-(2-iodoethyl)toluene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.