CAS 940315-22-0

Tetrahydro-2-methyl-2-thiophenecarbonitrile

Description:

Tetrahydro-2-methyl-2-thiophenecarbonitrile, identified by its CAS number 940315-22-0, is an organic compound characterized by its unique structure, which includes a thiophene ring and a nitrile functional group. This compound features a tetrahydro configuration, indicating that it has a saturated cyclic structure with four hydrogen atoms added to the thiophene ring, which typically contains sulfur. The presence of the methyl group contributes to its overall stability and reactivity. Tetrahydro-2-methyl-2-thiophenecarbonitrile is likely to exhibit properties typical of nitriles, such as moderate polarity and potential for hydrogen bonding, which can influence its solubility in various solvents. Additionally, compounds containing thiophene rings are often noted for their electronic properties, making them of interest in materials science and organic electronics. While specific physical properties such as melting point, boiling point, and solubility may vary, the compound's structure suggests it could be utilized in synthetic organic chemistry and potentially in pharmaceutical applications.

Formula: C₆H₉NS

InChI: InChI=1S/C6H9NS/c1-6(5-7)3-2-4-8-6/h2-4H2,1H3

InChI key: InChIKey=LELSDQAZXARHFP-UHFFFAOYSA-N

SMILES: C(#N)C1(C)CCCS1

Synonyms:

• 2-Methyl-2-tetrahydrothiophenecarbonitrile
• 2-Thiophenecarbonitrile, tetrahydro-2-methyl-
• 2-Methylthiolane-2-carbonitrile
• Tetrahydro-2-methyl-2-thiophenecarbonitrile