CAS 94043-06-8
:5-(Fluoromethyl)-2-furancarboxaldehyde
Description:
5-(Fluoromethyl)-2-furancarboxaldehyde is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a fluoromethyl group (-CH2F) and an aldehyde functional group (-CHO) attached to the furan ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the fluoromethyl group can enhance the compound's lipophilicity and influence its biological activity, making it of interest in medicinal chemistry. The aldehyde functional group allows for further chemical modifications, enabling the synthesis of various derivatives. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is important to handle it with care, as it may exhibit toxicity or irritant properties. Its unique structure and functional groups make it a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals.
Formula:C6H5FO2
InChI:InChI=1S/C6H5FO2/c7-3-5-1-2-6(4-8)9-5/h1-2,4H,3H2
InChI key:InChIKey=NWOKZDMHAXVEJJ-UHFFFAOYSA-N
SMILES:C(F)C=1OC(C=O)=CC1
Synonyms:- 2-Furancarboxaldehyde, 5-(fluoromethyl)-
- 5-(Fluoromethyl)-2-furancarboxaldehyde
- 5-(Fluoromethyl)Furan-2-Carbaldehyde
- 5-Fluoromethylfurfural
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.