CAS 94048-47-2

1-[(4R,6S,6aR)-6-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-chloro-pyrimidine-2,4-dione

Description:

The chemical substance known as 1-[(4R,6S,6aR)-6-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-chloro-pyrimidine-2,4-dione, with the CAS number 94048-47-2, is a complex organic compound characterized by its unique structural features. It contains a pyrimidine ring, which is a six-membered heterocyclic compound with nitrogen atoms, and is substituted with a chloro group and a dioxolane moiety. The presence of an iodomethyl group indicates potential reactivity, making it useful in various synthetic applications. The stereochemistry of the compound is defined by specific configurations at certain carbon centers, which can influence its biological activity and interactions. This compound may exhibit properties such as solubility in organic solvents, stability under certain conditions, and potential biological activity, making it of interest in medicinal chemistry and drug development. Its complex structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, depending on the functional groups present.

Formula: C₁₂H₁₄ClIN₂O₅

InChI: InChI=1/C12H14ClIN2O5/c1-12(2)20-7-6(3-14)19-10(8(7)21-12)16-4-5(13)9(17)15-11(16)18/h4,6-8,10H,3H2,1-2H3,(H,15,17,18)/t6-,7+,8?,10-/m1/s1

5’-Deoxy-5’-iodo-2’,3’-O-isopropylidene-5-chlorouridine

CAS: 94048-47-2

Ref: 7W-GN0370

5’-Deoxy-5’-iodo-2’,3’-O-isopropylidene-5-chlorouridine

Controlled Product

CAS: 94048-47-2

Formula: C₁₂H₁₄ClIN₂O₅

Color and Shape: Neat

Molecular weight: 428.61

Ref: TR-D239825

5'-Deoxy-5'-iodo-2',3'-O-isopropylidene-5-chlorouridine

CAS: 94048-47-2

5'-Deoxy-5'-iodo-2',3'-O-isopropylidene-5-chlorouridine is a novel antiviral agent that inhibits replication of viruses. It is synthesized from 5'-deoxy-5'-iodo-2',3'-O-isopropylideneuridine, which is then phosphorylated by the addition of a phosphate group. This compound has shown to be an activator in the synthesis of ribonucleosides and deoxyribonucleosides. The high purity and high quality of this compound make it suitable for use as a starting material for the synthesis of modified nucleosides for anticancer drugs.

Formula: C₁₂H₁₄ClIN₂O₅

Purity: Min. 95%

Molecular weight: 428.61 g/mol

Ref: 3D-ND16525