CAS 94061-90-2

2-Azaspiro[4.5]decane-3-carboxylic acid

Description:

2-Azaspiro[4.5]decane-3-carboxylic acid is a bicyclic compound characterized by its unique spiro structure, which consists of a nitrogen-containing heterocycle fused to a cycloalkane. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the nitrogen atom in the spiro framework suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions or coordination with metal ions. The spirocyclic nature of the molecule can influence its conformational flexibility and steric interactions, which may affect its biological activity and pharmacological properties. Additionally, the compound's structural features may render it useful in medicinal chemistry, particularly in the design of novel therapeutic agents. Its specific applications and interactions would depend on further studies, including its solubility, stability, and reactivity under different conditions. Overall, 2-Azaspiro[4.5]decane-3-carboxylic acid represents an interesting class of compounds with potential implications in various fields of chemistry and biochemistry.

Formula: C₁₀H₁₇NO₂

InChI: InChI=1S/C10H17NO2/c12-9(13)8-6-10(7-11-8)4-2-1-3-5-10/h8,11H,1-7H2,(H,12,13)

InChI key: InChIKey=QATSWWZBTBBYRX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC2(CN1)CCCCC2

Synonyms:

• 2-Azaspiro[4.5]decane-3-carboxylic acid
• 2-Azaspiro[4.5]decane-3-carboxylic acid, (±)-