CymitQuimica logo

CAS 94067-27-3

:

7-benzyloxygramine crystalline

Description:
7-Benzyloxygramine is a chemical compound characterized by its unique structure, which includes a benzyloxy group attached to a gramine backbone. This compound is typically found in a crystalline form, indicating a well-defined molecular arrangement that contributes to its stability and potential solubility properties. The presence of the benzyloxy group may enhance its lipophilicity, potentially influencing its biological activity and interaction with various receptors or enzymes. As a derivative of gramine, it may exhibit pharmacological properties, although specific biological activities would depend on further empirical studies. The compound's CAS number, 94067-27-3, allows for precise identification in chemical databases, facilitating research and application in fields such as medicinal chemistry and pharmacology. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, 7-benzyloxygramine represents a compound of interest for further investigation in both synthetic and applied chemistry contexts.
Formula:C18H20N2O
InChI:InChI=1/C18H20N2O/c1-20(2)12-15-11-19-18-16(15)9-6-10-17(18)21-13-14-7-4-3-5-8-14/h3-11,19H,12-13H2,1-2H3
SMILES:CN(C)Cc1c[nH]c2c1cccc2OCc1ccccc1
Synonyms:
  • 7-Benzyloxygramine
  • 1-[7-(benzyloxy)-1H-indol-3-yl]-N,N-dimethylmethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.