CAS 94078-20-3
:5-(2-Methoxyphenyl)-2-furancarboxaldehyde
Description:
5-(2-Methoxyphenyl)-2-furancarboxaldehyde is an organic compound characterized by its unique structure, which includes a furan ring and a methoxy-substituted phenyl group. This compound typically appears as a pale yellow to light brown liquid or solid, depending on its purity and form. It features a furan moiety, which contributes to its aromatic properties and potential reactivity, particularly in electrophilic substitution reactions. The presence of the aldehyde functional group makes it a versatile intermediate in organic synthesis, allowing for further derivatization. Additionally, the methoxy group enhances its solubility in organic solvents and may influence its electronic properties, making it useful in various applications, including pharmaceuticals and agrochemicals. The compound's molecular structure suggests potential biological activity, although specific biological properties would require further investigation. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C12H10O3
InChI:InChI=1S/C12H10O3/c1-14-11-5-3-2-4-10(11)12-7-6-9(8-13)15-12/h2-8H,1H3
InChI key:InChIKey=UQEVFNBSWIQVLF-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)C=2OC(C=O)=CC2
Synonyms:- 5-(2-Methoxyphenyl)-2-furancarboxaldehyde
- 2-Furancarboxaldehyde, 5-(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
