CAS 94084-70-5

5-[(methylsulfanyl)methyl]furan-2-carboxylate

Description:

5-[(Methylsulfanyl)methyl]furan-2-carboxylate, with the CAS number 94084-70-5, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a methylsulfanyl group, indicating the presence of a sulfur atom bonded to a methyl group, which contributes to its unique chemical properties. The carboxylate functional group suggests that it can participate in various chemical reactions, including esterification and nucleophilic substitutions. The presence of the furan ring often imparts interesting reactivity and potential biological activity, making it of interest in medicinal chemistry and organic synthesis. Additionally, the compound's solubility and stability can be influenced by the substituents on the furan ring and the carboxylate group. Overall, 5-[(methylsulfanyl)methyl]furan-2-carboxylate is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₇H₈O₃S

InChI: InChI=1/C7H8O3S/c1-11-4-5-2-3-6(10-5)7(8)9/h2-3H,4H2,1H3,(H,8,9)

SMILES: CSCc1ccc(C(=O)[O-])o1

5-[(Methylthio)methyl]-2-furoic acid

CAS: 94084-70-5

Versatile small molecule scaffold

Formula: C₇H₈O₃S

Purity: Min. 95%

Molecular weight: 172.2 g/mol

Ref: 3D-UDA08470