CAS 94084-72-7

(2Z)-2-(furan-2-ylmethylidene)butanoic acid

Description:

(2Z)-2-(furan-2-ylmethylidene)butanoic acid, with the CAS number 94084-72-7, is an organic compound characterized by its unique structure that includes a furan ring and a butanoic acid moiety. This compound features a double bond configuration (Z) at the second carbon, indicating that the substituents on the double bond are on the same side, which can influence its reactivity and physical properties. The presence of the furan ring contributes to its aromatic characteristics, potentially affecting its stability and interactions with other molecules. As a butanoic acid derivative, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Overall, (2Z)-2-(furan-2-ylmethylidene)butanoic acid represents a versatile structure with potential applications in various fields of chemistry and biochemistry.

Formula: C₉H₁₀O₃

InChI: InChI=1/C9H10O3/c1-2-7(9(10)11)6-8-4-3-5-12-8/h3-6H,2H2,1H3,(H,10,11)/b7-6-