CAS 94086-47-2
:α-2-Propen-1-ylbenzeneacetic acid
Description:
α-2-Propen-1-ylbenzeneacetic acid, also known by its CAS number 94086-47-2, is an organic compound characterized by its unique structure, which features both an alkenyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including moderate solubility in organic solvents and limited solubility in water due to the hydrophobic aromatic ring. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the alkenyl group can undergo reactions typical of alkenes, such as polymerization or addition reactions. The compound may also exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its stability and reactivity can be influenced by environmental factors such as temperature and pH. Overall, α-2-Propen-1-ylbenzeneacetic acid is a versatile compound with potential applications in various fields, including organic synthesis and medicinal chemistry.
Formula:C11H12O2
InChI:InChI=1S/C11H12O2/c1-2-6-10(11(12)13)9-7-4-3-5-8-9/h2-5,7-8,10H,1,6H2,(H,12,13)
InChI key:InChIKey=IQZLXJUYCRPXRG-UHFFFAOYSA-N
SMILES:C(CC=C)(C(O)=O)C1=CC=CC=C1
Synonyms:- α-2-Propen-1-ylbenzeneacetic acid
- Benzeneacetic acid, α-2-propenyl-, (±)-
- Benzeneacetic acid, α-2-propen-1-yl-
- 4-Pentenoic acid, 2-phenyl-
- Benzeneacetic acid, α-2-propenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Phenylpent-4-enoic acid
CAS:<p>2-Phenylpent-4-enoic acid is a macrocyclic molecule that is expressed in the liver and other organs. It belongs to the group of organomercurials, which are antifungal drugs. 2-Phenylpent-4-enoic acid has been shown to exhibit in vitro antifungal activity against Aspergillus niger, Candida albicans and Trichophyton mentagrophytes. The pharmacological profiles of this compound have been determined by evaluating its effects on protein synthesis and cell growth. It is a reductive eliminator of carbonyls, which may be due to the presence of two double bonds in its structure; this property makes it useful as an antifungal drug.</p>Formula:C11H12O2Purity:Min. 95%Molecular weight:176.21 g/mol

