CymitQuimica logo

CAS 94086-71-2

:

Boric acid (H3BO3), compd. with 2-amino-1-butanol

Description:
Boric acid (H3BO3) when combined with 2-amino-1-butanol forms a complex that exhibits unique characteristics. This compound typically appears as a white crystalline solid and is soluble in water, which enhances its utility in various applications. The presence of the amino alcohol contributes to its potential as a buffering agent and may influence its pH stability in solution. The compound can exhibit mild antiseptic properties due to the boric acid component, making it relevant in pharmaceutical and cosmetic formulations. Additionally, the interaction between boric acid and 2-amino-1-butanol can lead to the formation of hydrogen bonds, which may affect the compound's thermal stability and solubility profile. This combination is often explored in the context of drug delivery systems and as a potential additive in agricultural formulations. Overall, the characteristics of this compound are defined by the synergistic effects of its constituent parts, leading to applications in various fields, including medicine and agriculture.
Formula:C4H11NO·xBH3O3
InChI:InChI=1S/C4H11NO.BH3O3/c1-2-4(5)3-6;2-1(3)4/h4,6H,2-3,5H2,1H3;2-4H
InChI key:InChIKey=YRKQDTHCYONJQI-UHFFFAOYSA-N
SMILES:B(O)(O)O.C(CC)(CO)N
Synonyms:
  • Boric acid (H3BO3), compd. with 2-amino-1-butanol
  • 1-Butanol, 2-amino-, compd. with boric acid (H3BO3)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.