CymitQuimica logo

CAS 94086-79-0

:

3-(4,5-Dihydro-1H-imidazol-2-yl)benzenamine

Description:
3-(4,5-Dihydro-1H-imidazol-2-yl)benzenamine, with the CAS number 94086-79-0, is an organic compound characterized by its imidazole and aniline functional groups. This substance features a benzene ring substituted with an amino group and a dihydroimidazole moiety, which contributes to its potential biological activity. The presence of the imidazole ring suggests that it may exhibit properties relevant to medicinal chemistry, such as antimicrobial or anti-inflammatory effects. The compound is likely to be a solid at room temperature, with solubility influenced by the presence of polar functional groups. Its molecular structure allows for various interactions, including hydrogen bonding, which can affect its reactivity and stability. Additionally, the compound may participate in various chemical reactions typical of amines and heterocycles, making it of interest in synthetic organic chemistry and drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C9H11N3
InChI:InChI=1S/C9H11N3/c10-8-3-1-2-7(6-8)9-11-4-5-12-9/h1-3,6H,4-5,10H2,(H,11,12)
InChI key:InChIKey=HCJAVYDERMMIDO-UHFFFAOYSA-N
SMILES:NC=1C=C(C=CC1)C=2NCCN2
Synonyms:
  • 3-(4,5-Dihydro-1H-imidazol-2-yl)benzenamine
  • Benzenamine, 3-(4,5-dihydro-1H-imidazol-2-yl)-
  • 3-(4,5-Dihydro-1H-imidazol-2-yl)aniline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.