CymitQuimica logo

CAS 94086-87-0

:

3-[2-(3-Amino-4-hydroxyphenyl)diazenyl]benzenesulfonic acid

Description:
3-[2-(3-Amino-4-hydroxyphenyl)diazenyl]benzenesulfonic acid, with the CAS number 94086-87-0, is an organic compound characterized by its azo structure, which features a diazo group (-N=N-) linking two aromatic systems. This compound contains a sulfonic acid group (-SO3H), which enhances its solubility in water and contributes to its acidic properties. The presence of amino (-NH2) and hydroxy (-OH) functional groups on the aromatic ring indicates that it may exhibit both basic and acidic characteristics, making it a potential candidate for various chemical reactions and applications. The compound is likely to be used in dye chemistry, particularly in the synthesis of azo dyes, due to its vivid coloration properties. Additionally, the sulfonic acid group can facilitate interactions with other molecules, enhancing its utility in biological and industrial applications. Overall, this compound's unique functional groups and structural features make it significant in both synthetic and applied chemistry contexts.
Formula:C12H11N3O4S
InChI:InChI=1S/C12H11N3O4S/c13-11-7-9(4-5-12(11)16)15-14-8-2-1-3-10(6-8)20(17,18)19/h1-7,16H,13H2,(H,17,18,19)
InChI key:InChIKey=KAIXUKQIBZNQND-UHFFFAOYSA-N
SMILES:N(=NC1=CC(N)=C(O)C=C1)C2=CC(S(=O)(=O)O)=CC=C2
Synonyms:
  • 3-[2-(3-Amino-4-hydroxyphenyl)diazenyl]benzenesulfonic acid
  • Benzenesulfonic acid, 3-[(3-amino-4-hydroxyphenyl)azo]-
  • Benzenesulfonic acid, 3-[2-(3-amino-4-hydroxyphenyl)diazenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.