CAS 94087-72-6

5-Hexyl-2,4,6-pyrimidinetriamine

Description:

5-Hexyl-2,4,6-pyrimidinetriamine, with the CAS number 94087-72-6, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 2 and 4. The presence of a hexyl group at position 5 contributes to its hydrophobic properties, potentially influencing its solubility and interaction with biological membranes. This compound features three amine groups, which can participate in hydrogen bonding and may enhance its reactivity and ability to form complexes with various substrates. Due to its structural features, 5-Hexyl-2,4,6-pyrimidinetriamine may exhibit interesting biological activities, making it a candidate for research in medicinal chemistry or materials science. Its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.

Formula: C₁₀H₁₉N₅

InChI: InChI=1S/C10H19N5/c1-2-3-4-5-6-7-8(11)14-10(13)15-9(7)12/h2-6H2,1H3,(H6,11,12,13,14,15)

InChI key: InChIKey=RLGBSGOJEYAKKB-UHFFFAOYSA-N

SMILES: C(CCCCC)C=1C(N)=NC(N)=NC1N

Synonyms:

• 2,4,6-Pyrimidinetriamine, 5-hexyl-
• 5-Hexyl-2,4,6-pyrimidinetriamine
• 5-Hexylpyrimidine-2,4,6-triamine