CAS 94088-90-1
:(16α)-16,17-Epoxypregna-4,9(11)-diene-3,20-dione
Description:
The chemical substance known as "(16α)-16,17-Epoxypregna-4,9(11)-diene-3,20-dione," with the CAS number 94088-90-1, is a steroid compound characterized by its unique epoxide structure and specific functional groups. This compound features a pregnane backbone, which is a common structure in steroid chemistry, and includes a diene system that contributes to its reactivity and biological activity. The presence of the epoxide group indicates that it can participate in various chemical reactions, potentially leading to the formation of other derivatives. Its dione functionality suggests that it may exhibit significant biological activity, possibly interacting with steroid receptors or influencing metabolic pathways. The stereochemistry, particularly the 16α configuration, is crucial for its biological properties and interactions. Such compounds are often studied for their potential therapeutic applications, including anti-inflammatory or hormonal effects. Overall, this substance exemplifies the complexity and diversity of steroid chemistry, with implications in both pharmacology and biochemistry.
Formula:C21H26O3
InChI:InChI=1S/C21H26O3/c1-12(22)21-18(24-21)11-17-15-5-4-13-10-14(23)6-8-19(13,2)16(15)7-9-20(17,21)3/h7,10,15,17-18H,4-6,8-9,11H2,1-3H3/t15-,17+,18-,19+,20+,21-/m1/s1
InChI key:InChIKey=IPXGZQHGJWTQTD-UERYMFTHSA-N
SMILES:C(C)(=O)[C@]12[C@]3(C)[C@@](C[C@]1(O2)[H])([C@]4(C(=CC3)[C@]5(C)C(CC4)=CC(=O)CC5)[H])[H]
Synonyms:- (16α)-16,17-Epoxypregna-4,9(11)-diene-3,20-dione
- 16,17-Epoxy-3H-cyclopenta[a]phenanthrene, pregna-4,9(11)-diene-3,20-dione deriv.
- 16alpha,17-Epoxypregna-4,9(11)-diene-3,20-dione
- Pregna-4,9(11)-diene-3,20-dione, 16,17-epoxy-, (16α)-
- Pregna-4,9(11)-diene-3,20-dione, 16α,17-epoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
16alpha,17-Epoxypregna-4,9(11)-diene-3,20-dione
CAS:Controlled ProductApplications 16α,17-Epoxypregna-4,9(11)-diene-3,20-dione is an intermediate in the synthesis of 16-Hydroxycorticosterone 20-Hydroxy-21-Acid (H918430), an oxidized derivative of corticosterone (C695700).
References Allen, G.R., et al.: J. Am. Chem. Soc., 81, 4968 (1959);Formula:C21H26O3Color and Shape:NeatMolecular weight:326.43
