CAS 94088-91-2
:(9β,11β,16α)-9,11-Epoxy-16,17,21-trihydroxypregna-1,4-diene-3,20-dione
Description:
The chemical substance known as "(9β,11β,16α)-9,11-Epoxy-16,17,21-trihydroxypregna-1,4-diene-3,20-dione," with the CAS number 94088-91-2, is a steroid compound characterized by its complex structure, which includes multiple hydroxyl groups and an epoxy group. This compound is derived from the steroid framework, specifically the pregnane series, and exhibits significant biological activity, often related to its role in modulating hormonal pathways. The presence of hydroxyl groups contributes to its solubility in polar solvents and its potential interactions with biological receptors. The epoxy group introduces unique reactivity, which can influence its pharmacological properties. This compound is of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents that target steroid hormone pathways. Its specific stereochemistry, denoted by the nomenclature, indicates the spatial arrangement of atoms, which is crucial for its biological function and activity. Overall, this substance represents a significant area of study in the context of steroid biochemistry and therapeutic applications.
Formula:C21H26O6
InChI:InChI=1S/C21H26O6/c1-18-6-5-12(23)7-11(18)3-4-13-14-8-15(24)20(26,16(25)10-22)19(14,2)9-17-21(13,18)27-17/h5-7,13-15,17,22,24,26H,3-4,8-10H2,1-2H3/t13-,14-,15+,17-,18-,19-,20-,21+/m0/s1
InChI key:InChIKey=MJJGOAZIKWEYHG-APPPZISSSA-N
SMILES:C[C@@]12[C@@]34[C@]([C@]5([C@](C)(C[C@@]3(O4)[H])[C@](C(CO)=O)(O)[C@H](O)C5)[H])(CCC1=CC(=O)C=C2)[H]
Synonyms:- (9β,11β,16α)-9,11-Epoxy-16,17,21-trihydroxypregna-1,4-diene-3,20-dione
- 9,11-Epoxy-9H-cyclopenta[a]phenanthrene, pregna-1,4-diene-3,20-dione deriv.
- 9beta,11beta-Epoxy-16alpha,17,21-trihydroxypregna-1,4-diene-3,20-dione
- Pregna-1,4-diene-3,20-dione, 9,11-epoxy-16,17,21-trihydroxy-, (9β,11β,16α)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(9β,11β,16α)-9,11-Epoxy-16,17,21-trihydroxypregna-1,4-diene-3,20-dione
CAS:Controlled Product<p>Applications (9β,11β,16α)-9,11-Epoxy-16,17,21-trihydroxypregna-1,4-diene-3,20-dione is used as a reactant in the synthesis of triamcinolone acetonide, a synthetic corticosteroid used to treat skin conditions.<br>References Wang, Haibo, et al.: Henan Lihua Pharmaceutical Co., CN 106905406 A 20170630 (2017)<br></p>Formula:C21H26O6Color and Shape:NeatMolecular weight:374.43
