CymitQuimica logo

CAS 940948-30-1

:

4-Chloro-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine

Description:
4-Chloro-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine core substituted with chlorine and iodine atoms, as well as a phenylsulfonyl group. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and reactivity due to the presence of halogen substituents. The chlorine and iodine atoms can influence the compound's electronic properties and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The phenylsulfonyl group may enhance solubility and stability, as well as contribute to the compound's pharmacological profile. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the presence of multiple functional groups suggests that this compound may participate in diverse chemical interactions, making it of interest in both synthetic and medicinal chemistry research.
Formula:C13H8ClIN2O2S
InChI:InChI=1S/C13H8ClIN2O2S/c14-11-6-7-16-13-10(11)8-12(15)17(13)20(18,19)9-4-2-1-3-5-9/h1-8H
InChI key:InChIKey=QOYGFOVKGYRFHN-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C=C1I)=C(Cl)C=CN2)C3=CC=CC=C3
Synonyms:
  • 1-(Phenylsulfonyl)-4-chloro-2-iodopyrrolo[2,3-b]pyridine
  • 1-Benzenesulfonyl-4-chloro-2-iodo-7-azaindole
  • 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-2-iodo-1-(phenylsulfonyl)-
  • 4-Chloro-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
  • 1-(Benzenesulfonyl)-4-chloro-2-iodo-pyrrolo[2,3-b]pyridine
Found 4 products.