
CAS 94095-05-3
:Boric acid (H3BO3), reaction products with 1-piperazineethanamine
Description:
Boric acid (H3BO3) is a weak acid that exhibits unique properties, including its ability to act as a mild antiseptic and insecticide. It is often used in various applications, including pharmaceuticals, cosmetics, and as a buffering agent. When boric acid reacts with 1-piperazineethanamine, a compound known for its amine functional group, the reaction typically involves the formation of a boron-nitrogen complex. This interaction can enhance the solubility and stability of the resulting product, which may exhibit improved biological activity or altered chemical properties compared to the individual reactants. The specific characteristics of the reaction products can vary based on the reaction conditions, such as temperature and concentration, but they generally retain some properties of both boric acid and the amine. The compound with CAS number 94095-05-3 is likely to have applications in medicinal chemistry or materials science, where the unique properties of boron and nitrogen are advantageous. Overall, the combination of boric acid and 1-piperazineethanamine highlights the versatility of boron-containing compounds in chemical synthesis.
Formula:C6H15N3·BH3O3
InChI:InChI=1S/C6H15N3.BH3O3/c7-1-4-9-5-2-8-3-6-9;2-1(3)4/h8H,1-7H2;2-4H
InChI key:InChIKey=AOGCQOSFOQYLSO-UHFFFAOYSA-N
SMILES:B(O)(O)O.C(CN)N1CCNCC1
Synonyms:- Boric acid (H3BO3), reaction products with 1-piperazineethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boric acid (H3BO3), reaction products with 1-piperazineethanamine
CAS:Formula:C6H18BN3O3Molecular weight:191.0364
