CAS 940980-96-1
:4-pyrrolidin-1-yl-1,3,5-triazin-2-amine
Description:
4-Pyrrolidin-1-yl-1,3,5-triazin-2-amine is a chemical compound characterized by its unique structure, which includes a triazine ring and a pyrrolidine moiety. This compound features a triazine core, which is a six-membered ring containing three nitrogen atoms and three carbon atoms, contributing to its potential reactivity and stability. The presence of the pyrrolidine group, a five-membered saturated ring containing one nitrogen atom, adds to its chemical properties, potentially influencing its solubility and interaction with biological systems. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential hydrogen bonding and interactions with biological targets. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which could be relevant in synthetic applications.
Formula:C7H11N5
InChI:InChI=1/C7H11N5/c8-6-9-5-10-7(11-6)12-3-1-2-4-12/h5H,1-4H2,(H2,8,9,10,11)
SMILES:C1CCN(C1)c1ncnc(=N)[nH]1
Synonyms:- 1,3,5-Triazin-2-Amine, 4-(1-Pyrrolidinyl)-
- (4-pyrrolidin-1-yl-s-triazin-2-yl)amine
- 4-(1-PYRROLIDINYL)-1,3,5-TRIAZIN-2-AMINE
- 4-Pyrrolidin-1-yl-1,3,5-triazin-2-amine
- 4-(1-pyrrolidinyl)-1,3,5-triazin-2-amine(SALTDATA: FREE)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.