CAS 94099-50-0
:1,1,1,2,2-pentafluorohexane
Description:
1,1,1,2,2-Pentafluorohexane is a fluorinated hydrocarbon with the chemical formula C6H3F5. It is characterized by the presence of five fluorine atoms attached to a hexane backbone, specifically at the 1, 1, 1, 2, and 2 positions. This compound is a colorless liquid at room temperature and is known for its low volatility and high stability, which are typical of perfluorinated compounds. Its high electronegativity due to the fluorine atoms imparts unique properties, such as low surface tension and high chemical inertness, making it useful in various applications, including as a solvent and in specialty chemical processes. Additionally, 1,1,1,2,2-pentafluorohexane has a low global warming potential compared to other fluorinated compounds, which is an important consideration in environmental chemistry. However, like many fluorinated substances, it may pose concerns regarding persistence in the environment and potential bioaccumulation. Safety data sheets should be consulted for handling and exposure guidelines.
Formula:C6H9F5
InChI:InChI=1/C6H9F5/c1-2-3-4-5(7,8)6(9,10)11/h2-4H2,1H3
SMILES:CCCCC(C(F)(F)F)(F)F
Synonyms:- Hexane, 1,1,1,2,2-Pentafluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.