CymitQuimica logo

CAS 941-29-7

:

7,7,9-Trimethyl-1,4-dioxaspiro[4.5]decane

Description:
7,7,9-Trimethyl-1,4-dioxaspiro[4.5]decane is a chemical compound characterized by its unique spirocyclic structure, which consists of a dioxane ring fused to a decane framework. This compound features two ether linkages within the dioxane moiety, contributing to its stability and potential reactivity. The presence of three methyl groups at the 7 and 9 positions enhances its steric bulk, which can influence its physical properties, such as boiling point and solubility. Typically, compounds like this may exhibit moderate polarity due to the dioxane structure, affecting their interactions with solvents and other chemical species. The spiro configuration often leads to interesting conformational dynamics, which can impact the compound's reactivity in various chemical reactions. Additionally, the compound may have applications in organic synthesis or as a building block in the development of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H20O2
InChI:InChI=1S/C11H20O2/c1-9-6-10(2,3)8-11(7-9)12-4-5-13-11/h9H,4-8H2,1-3H3
InChI key:InChIKey=ZTUOQBOZIFOYMP-UHFFFAOYSA-N
SMILES:CC1(C)CC2(CC(C)C1)OCCO2
Synonyms:
  • 3,3,5-Trimethylcyclohexanone ethylene acetal
  • 7,7,9-Trimethyl-1,4-dioxaspiro[4.5]decane
  • 1,4-Dioxaspiro[4.5]decane, 7,7,9-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.