CAS 941-37-7
:1-Bromo-3,5-dimethyladamantane
Description:
1-Bromo-3,5-dimethyladamantane is a chemical compound characterized by its adamantane structure, which consists of a fused polycyclic framework. This compound features a bromine atom substituted at the 1-position and two methyl groups at the 3 and 5 positions of the adamantane core. The presence of the bromine atom introduces notable reactivity, making it useful in various organic synthesis applications. Its molecular formula typically includes carbon and hydrogen, reflecting the adamantane backbone, along with the bromine atom. The compound is generally solid at room temperature and exhibits moderate solubility in organic solvents. Due to its unique structure, it may exhibit interesting physical and chemical properties, such as stability under certain conditions and potential applications in medicinal chemistry or materials science. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 1-Bromo-3,5-dimethyladamantane is a notable example of a halogenated adamantane derivative with potential utility in various chemical contexts.
Formula:C12H19Br
InChI:InChI=1S/C12H19Br/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8H2,1-2H3
InChI key:InChIKey=QUCXLVDIVQWYJR-UHFFFAOYSA-N
SMILES:BrC12CC3(C)CC(C)(C1)CC(C2)C3
Synonyms:- 1,3-Dimethyl-5-bromoadamantane
- 1-Bromo-3,5-Dimethyl Adamantane
- 1-Bromo-3,5-Dimethyltricyclo[3.3.1.1~3,7~]Decane
- 1-Bromo-3,5-dimethylasamantane
- 1-Bromo-3,5-dimethyltricyclo[3.3.1.1<sup>3,7</sup>]decane
- 3,5-Dimethyl-1-bromoadamantane
- Adamantane, 1-bromo-3,5-dimethyl-
- NSC 102293
- Tricyclo[3.3.1.1<sup>3,7</sup>]decane, 1-bromo-3,5-dimethyl-
- Tricyclo[3.3.1.13,7]decane, 1-bromo-3,5-dimethyl-
- 1-Bromo-3,5-dimethyltricyclo[3.3.1.13,7]decane
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Bromo-3,5-dimethyladamantane
CAS:Formula:C12H19BrPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:243.19Memantine Related Compound D
CAS:Other halogenated derivatives of cyclanic, cyclenic or cycloterpenic hydrocarbons, excluding hexachlorocyclohexaneFormula:C12H19BrColor and Shape:Yellow LiquidMolecular weight:242.067011-Bromo-3,5-dimethyladamantane
CAS:Formula:C12H19BrPurity:98%Color and Shape:LiquidMolecular weight:243.18331-Bromo-3,5-dimethyladamantane
CAS:Formula:C12H19BrPurity:(GC) ≥ 97.0%Color and Shape:Colourless liquidMolecular weight:243.181-Bromo-3,5-dimethyladamantane
CAS:1-Bromo-3,5-dimethyladamantaneFormula:C12H19BrPurity:>98%Color and Shape:LiquidMolecular weight:243.18326Memantine USP Related Compound D
CAS:Formula:C12H19BrColor and Shape:Colorless LiquidMolecular weight:243.191-Bromo-3,5-dimethyladamantane
CAS:Controlled ProductApplications 1-Bromo-3,5-dimethyladamantane (cas# 941-37-7) is a compound useful in organic synthesis.
Formula:C12H19BrColor and Shape:NeatMolecular weight:243.18Memantine Related Compound D
CAS:1-Bromo-3,5-dimethyladamantaneFormula:C12H19BrPurity:98%Molecular weight:243.181-Bromo-3,5-dimethyladamantane
CAS:Formula:C12H19BrPurity:98%Color and Shape:LiquidMolecular weight:243.1881-Bromo-3,5-dimethyladamantane
CAS:Intermediate in the synthesis of memantineFormula:C12H19BrPurity:Min. 95%Molecular weight:243.18 g/mol











