
CAS 94108-15-3
:2-Chloro-N-methyl-6-nitrobenzenemethanamine
Description:
2-Chloro-N-methyl-6-nitrobenzenemethanamine, with the CAS number 94108-15-3, is an organic compound characterized by its aromatic structure, which includes a nitro group and a chloro substituent on a benzene ring. This compound features a primary amine functional group, contributing to its reactivity and potential applications in various chemical reactions. The presence of the nitro group typically enhances the electrophilic character of the aromatic ring, making it more susceptible to nucleophilic attack. The chloro substituent can also influence the compound's reactivity and solubility in different solvents. Generally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Additionally, the presence of both electron-withdrawing (nitro and chloro) and electron-donating (methyl) groups can lead to unique electronic properties, affecting the compound's stability and interaction with other molecules. Safety and handling precautions are essential due to the potential toxicity associated with nitro and amine groups.
Formula:C8H9ClN2O2
InChI:InChI=1S/C8H9ClN2O2/c1-10-5-6-7(9)3-2-4-8(6)11(12)13/h2-4,10H,5H2,1H3
InChI key:InChIKey=KLVFNRYOUGSYDE-UHFFFAOYSA-N
SMILES:C(NC)C1=C(N(=O)=O)C=CC=C1Cl
Synonyms:- Benzenemethanamine, 2-chloro-N-methyl-6-nitro-
- 2-Chloro-N-methyl-6-nitrobenzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.